C27H48AlO5 — CID 87241923
CID 87241923 (PubChem CID 87241923) has the molecular formula C27H48AlO5 and a molecular weight of 479.66 g/mol.
| Compound Name | CID 87241923 |
|---|---|
| PubChem CID | 87241923 |
| Molecular Formula | C27H48AlO5 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | — |
| SMILES | CC(C)C[Al]CC(C)C.CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2 |
| InChI | InChI=1S/C19H30O5.2C4H9.Al/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2;2*1-4(2)3;/h12-13H,3-11,14-15H2,1-2H3;2*4H,1H2,2-3H3; |
| InChIKey | TUBPIQPRAQLXEO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|