C23H40O5 — CID 135213419
4-[2-(2-butoxyethoxy)ethoxymethyl]-5-octylbenzene-1,2-diol (PubChem CID 135213419) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is 4-[2-(2-butoxyethoxy)ethoxymethyl]-5-octylbenzene-1,2-diol.
| Compound Name | 4-[2-(2-butoxyethoxy)ethoxymethyl]-5-octylbenzene-1,2-diol |
|---|---|
| PubChem CID | 135213419 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 4-[2-(2-butoxyethoxy)ethoxymethyl]-5-octylbenzene-1,2-diol |
| SMILES | CCCCCCCCc1cc(O)c(O)cc1COCCOCCOCCCC |
| InChI | InChI=1S/C23H40O5/c1-3-5-7-8-9-10-11-20-17-22(24)23(25)18-21(20)19-28-16-15-27-14-13-26-12-6-4-2/h17-18,24-25H,3-16,19H2,1-2H3 |
| InChIKey | KELFDQLGONFSNM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|