C28H50O8 — CID 23293321
2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]-4-nonylphenol (PubChem CID 23293321) has the molecular formula C28H50O8 and a molecular weight of 514.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]-4-nonylphenol.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]-4-nonylphenol |
|---|---|
| PubChem CID | 23293321 |
| Molecular Formula | C28H50O8 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]-4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)c(COCCOCCOCCOCCOCCOCCO)c1 |
| InChI | InChI=1S/C28H50O8/c1-2-3-4-5-6-7-8-9-26-10-11-28(30)27(24-26)25-36-23-22-35-21-20-34-19-18-33-17-16-32-15-14-31-13-12-29/h10-11,24,29-30H,2-9,12-23,25H2,1H3 |
| InChIKey | NTQAXULFQOQKIO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|