C23H34O4 — CID 144648391
ethane;3-[2-(2-hydroxyethoxy)ethoxy]-5-(4-pentylphenyl)phenol (PubChem CID 144648391) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is ethane;3-[2-(2-hydroxyethoxy)ethoxy]-5-(4-pentylphenyl)phenol.
| Compound Name | ethane;3-[2-(2-hydroxyethoxy)ethoxy]-5-(4-pentylphenyl)phenol |
|---|---|
| PubChem CID | 144648391 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | ethane;3-[2-(2-hydroxyethoxy)ethoxy]-5-(4-pentylphenyl)phenol |
| SMILES | CC.CCCCCc1ccc(-c2cc(O)cc(OCCOCCO)c2)cc1 |
| InChI | InChI=1S/C21H28O4.C2H6/c1-2-3-4-5-17-6-8-18(9-7-17)19-14-20(23)16-21(15-19)25-13-12-24-11-10-22;1-2/h6-9,14-16,22-23H,2-5,10-13H2,1H3;1-2H3 |
| InChIKey | JRMJCWPHBSSXQR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|