C42H52O8 — CID 160636627
ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate;5-(4-pentylphenyl)benzene-1,3-diol (PubChem CID 160636627) has the molecular formula C42H52O8 and a molecular weight of 684.87 g/mol. Its IUPAC name is ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate;5-(4-pentylphenyl)benzene-1,3-diol.
| Compound Name | ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate;5-(4-pentylphenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 160636627 |
| Molecular Formula | C42H52O8 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate;5-(4-pentylphenyl)benzene-1,3-diol |
| SMILES | CCCCCc1ccc(-c2cc(O)cc(O)c2)cc1.CCCCCc1ccc(-c2cc(OCC(=O)OCC)cc(OCC(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C25H32O6.C17H20O2/c1-4-7-8-9-19-10-12-20(13-11-19)21-14-22(30-17-24(26)28-5-2)16-23(15-21)31-18-25(27)29-6-3;1-2-3-4-5-13-6-8-14(9-7-13)15-10-16(18)12-17(19)11-15/h10-16H,4-9,17-18H2,1-3H3;6-12,18-19H,2-5H2,1H3 |
| InChIKey | RIPSPKFAQKSFPQ-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|