C26H36O6 — CID 144648395
ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-6-methyl-5-(4-pentylphenyl)cyclohexa-2,4-dien-1-yl]oxyacetate (PubChem CID 144648395) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-6-methyl-5-(4-pentylphenyl)cyclohexa-2,4-dien-1-yl]oxyacetate.
| Compound Name | ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-6-methyl-5-(4-pentylphenyl)cyclohexa-2,4-dien-1-yl]oxyacetate |
|---|---|
| PubChem CID | 144648395 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-6-methyl-5-(4-pentylphenyl)cyclohexa-2,4-dien-1-yl]oxyacetate |
| SMILES | CCCCCc1ccc(C2=CC(OCC(=O)OCC)=CC(OCC(=O)OCC)C2C)cc1 |
| InChI | InChI=1S/C26H36O6/c1-5-8-9-10-20-11-13-21(14-12-20)23-15-22(31-17-25(27)29-6-2)16-24(19(23)4)32-18-26(28)30-7-3/h11-16,19,24H,5-10,17-18H2,1-4H3 |
| InChIKey | SFONNGDTYLSFIZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|