C19H30O5W — CID 87115513
5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;tungsten (PubChem CID 87115513) has the molecular formula C19H30O5W and a molecular weight of 522.28 g/mol. Its IUPAC name is 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;tungsten.
| Compound Name | 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;tungsten |
|---|---|
| PubChem CID | 87115513 |
| Molecular Formula | C19H30O5W |
| Molecular Weight | 522.28 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;tungsten |
| SMILES | CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2.[W] |
| InChI | InChI=1S/C19H30O5.W/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2;/h12-13H,3-11,14-15H2,1-2H3; |
| InChIKey | MGAQIMFCSCGPSF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|