C25H34Cl5O6P — CID 88711288
5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;2,3,4,5,6-pentachlorophenol;phosphane (PubChem CID 88711288) has the molecular formula C25H34Cl5O6P and a molecular weight of 638.78 g/mol. Its IUPAC name is 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;2,3,4,5,6-pentachlorophenol;phosphane.
| Compound Name | 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;2,3,4,5,6-pentachlorophenol;phosphane |
|---|---|
| PubChem CID | 88711288 |
| Molecular Formula | C25H34Cl5O6P |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole;2,3,4,5,6-pentachlorophenol;phosphane |
| SMILES | CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.P |
| InChI | InChI=1S/C19H30O5.C6HCl5O.H3P/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2;7-1-2(8)4(10)6(12)5(11)3(1)9;/h12-13H,3-11,14-15H2,1-2H3;12H;1H3 |
| InChIKey | VSZHIZFJCHADIO-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|