ethyl 6-propyl-1,3-benzodioxole-5-carboxylate

C13H16O4 — CID 91664941

IUPACethyl 6-propyl-1,3-benzodioxole-5-carboxylate
SMILESCCCc1cc2c(cc1C(=O)OCC)OCO2
InChIInChI=1S/C13H16O4/c1-3-5-9-6-11-12(17-8-16-11)7-10(9)13(14)15-4-2/h6-7H,3-5,8H2,1-2H3
InChIKeyCWBAAKLVQQXGMT-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.54
Rot. Bonds4

About ethyl 6-propyl-1,3-benzodioxole-5-carboxylate

ethyl 6-propyl-1,3-benzodioxole-5-carboxylate (PubChem CID 91664941) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 6-propyl-1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Nameethyl 6-propyl-1,3-benzodioxole-5-carboxylate
PubChem CID91664941
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Nameethyl 6-propyl-1,3-benzodioxole-5-carboxylate
SMILESCCCc1cc2c(cc1C(=O)OCC)OCO2
InChIInChI=1S/C13H16O4/c1-3-5-9-6-11-12(17-8-16-11)7-10(9)13(14)15-4-2/h6-7H,3-5,8H2,1-2H3
InChIKeyCWBAAKLVQQXGMT-UHFFFAOYSA-N
XLogP2.54
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 6-propyl-1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 6-propyl-1,3-benzodioxole-5-carboxylate?
The IUPAC name of ethyl 6-propyl-1,3-benzodioxole-5-carboxylate (CID 91664941) is ethyl 6-propyl-1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for ethyl 6-propyl-1,3-benzodioxole-5-carboxylate?
The canonical SMILES for ethyl 6-propyl-1,3-benzodioxole-5-carboxylate is CCCc1cc2c(cc1C(=O)OCC)OCO2.
What is the InChIKey of ethyl 6-propyl-1,3-benzodioxole-5-carboxylate?
The InChIKey is CWBAAKLVQQXGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-3-5-9-6-11-12(17-8-16-11)7-10(9)13(14)15-4-2/h6-7H,3-5,8H2,1-2H3.
What are the key properties of ethyl 6-propyl-1,3-benzodioxole-5-carboxylate?
ethyl 6-propyl-1,3-benzodioxole-5-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-propyl-1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 91664941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).