C12H14O2Si — CID 10911026
2-(1,3-benzodioxol-5-yl)ethynyl-trimethylsilane (PubChem CID 10911026) has the molecular formula C12H14O2Si and a molecular weight of 218.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(1,3-benzodioxol-5-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10911026 |
| Molecular Formula | C12H14O2Si |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14O2Si/c1-15(2,3)7-6-10-4-5-11-12(8-10)14-9-13-11/h4-5,8H,9H2,1-3H3 |
| InChIKey | ZAIKPTXKIFHSKC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|