C32H35NO6 — CID 134864109
diethyl (3R,6R)-6-(5-oxo-4-tricyclo[5.2.1.02,6]dec-3-enyl)-2,3-diphenyloxazinane-4,4-dicarboxylate (PubChem CID 134864109) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is diethyl (3R,6R)-6-(5-oxo-4-tricyclo[5.2.1.02,6]dec-3-enyl)-2,3-diphenyloxazinane-4,4-dicarboxylate.
| Compound Name | diethyl (3R,6R)-6-(5-oxo-4-tricyclo[5.2.1.02,6]dec-3-enyl)-2,3-diphenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 134864109 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | diethyl (3R,6R)-6-(5-oxo-4-tricyclo[5.2.1.02,6]dec-3-enyl)-2,3-diphenyloxazinane-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](C2=CC3C4CCC(C4)C3C2=O)ON(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H35NO6/c1-3-37-30(35)32(31(36)38-4-2)19-26(25-18-24-21-15-16-22(17-21)27(24)28(25)34)39-33(23-13-9-6-10-14-23)29(32)20-11-7-5-8-12-20/h5-14,18,21-22,24,26-27,29H,3-4,15-17,19H2,1-2H3/t21?,22?,24?,26-,27?,29-/m1/s1 |
| InChIKey | WRAXBMDFZYUVOI-NCNTXHPSSA-N |
| XLogP | 5.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|