C22H28O4 — CID 11760076
dimethyl 2-benzyl-2-[(3E)-octa-1,3-dien-2-yl]cyclopropane-1,1-dicarboxylate (PubChem CID 11760076) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is dimethyl 2-benzyl-2-[(3E)-octa-1,3-dien-2-yl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-benzyl-2-[(3E)-octa-1,3-dien-2-yl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11760076 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | dimethyl 2-benzyl-2-[(3E)-octa-1,3-dien-2-yl]cyclopropane-1,1-dicarboxylate |
| SMILES | C=C(/C=C/CCCC)C1(Cc2ccccc2)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H28O4/c1-5-6-7-9-12-17(2)21(15-18-13-10-8-11-14-18)16-22(21,19(23)25-3)20(24)26-4/h8-14H,2,5-7,15-16H2,1,3-4H3/b12-9+ |
| InChIKey | NSWCYFZNWGDPIY-FMIVXFBMSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|