C21H31NO6S — CID 54330486
[3,5-dihydroxy-2-[(2-phenylethylsulfonylamino)methyl]cyclopentyl] hept-2-enoate (PubChem CID 54330486) has the molecular formula C21H31NO6S and a molecular weight of 425.55 g/mol. Its IUPAC name is [3,5-dihydroxy-2-[(2-phenylethylsulfonylamino)methyl]cyclopentyl] hept-2-enoate.
| Compound Name | [3,5-dihydroxy-2-[(2-phenylethylsulfonylamino)methyl]cyclopentyl] hept-2-enoate |
|---|---|
| PubChem CID | 54330486 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [3,5-dihydroxy-2-[(2-phenylethylsulfonylamino)methyl]cyclopentyl] hept-2-enoate |
| SMILES | CCCCC=CC(=O)OC1C(O)CC(O)C1CNS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H31NO6S/c1-2-3-4-8-11-20(25)28-21-17(18(23)14-19(21)24)15-22-29(26,27)13-12-16-9-6-5-7-10-16/h5-11,17-19,21-24H,2-4,12-15H2,1H3 |
| InChIKey | SXZOLPGOSWQPBP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|