C23H34N2O5S — CID 88655468
(Z)-N-hydroxy-N-methyl-7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide (PubChem CID 88655468) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is (Z)-N-hydroxy-N-methyl-7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide.
| Compound Name | (Z)-N-hydroxy-N-methyl-7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
|---|---|
| PubChem CID | 88655468 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (Z)-N-hydroxy-N-methyl-7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
| SMILES | CN(O)C(=O)CCC/C=C\C[C@@H]1[C@H](CNS(=O)(=O)CCc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H34N2O5S/c1-25(27)23(26)12-8-3-2-7-11-19-20(22-14-13-21(19)30-22)17-24-31(28,29)16-15-18-9-5-4-6-10-18/h2,4-7,9-10,19-22,24,27H,3,8,11-17H2,1H3/b7-2-/t19-,20+,21-,22+/m1/s1 |
| InChIKey | PBZURYWPBBHUHW-XIYHLMFVSA-N |
| XLogP | 2.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|