C22H33NO5S — CID 57258347
7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 57258347) has the molecular formula C22H33NO5S and a molecular weight of 423.58 g/mol. Its IUPAC name is 7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 57258347 |
| Molecular Formula | C22H33NO5S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 7-[(1R,2R,3R,4S)-3-[(2-phenylethylsulfonylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@H](CNS(=O)(=O)CCc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C22H33NO5S/c24-22(25)11-7-2-1-6-10-18-19(21-13-12-20(18)28-21)16-23-29(26,27)15-14-17-8-4-3-5-9-17/h3-5,8-9,18-21,23H,1-2,6-7,10-16H2,(H,24,25)/t18-,19+,20-,21+/m1/s1 |
| InChIKey | YRWPBEBDEHCKHT-MHTWAQMVSA-N |
| XLogP | 3.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|