C29H38O5 — CID 18598922
7-[3-[2-[(1S,2S,3R,4R)-3-(2-phenoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]heptanoic acid (PubChem CID 18598922) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is 7-[3-[2-[(1S,2S,3R,4R)-3-(2-phenoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]heptanoic acid.
| Compound Name | 7-[3-[2-[(1S,2S,3R,4R)-3-(2-phenoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 18598922 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 7-[3-[2-[(1S,2S,3R,4R)-3-(2-phenoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]heptanoic acid |
| SMILES | O=C(O)CCCCCCOc1cccc(CC[C@H]2[C@@H](CCOc3ccccc3)[C@H]3CC[C@@H]2O3)c1 |
| InChI | InChI=1S/C29H38O5/c30-29(31)13-6-1-2-7-19-32-24-12-8-9-22(21-24)14-15-25-26(28-17-16-27(25)34-28)18-20-33-23-10-4-3-5-11-23/h3-5,8-12,21,25-28H,1-2,6-7,13-20H2,(H,30,31)/t25-,26+,27-,28+/m0/s1 |
| InChIKey | HTVYFQYEFJEPNZ-ZVBOOHQUSA-N |
| XLogP | 6.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|