C23H34O5 — CID 18598931
2-[3-[2-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]acetic acid (PubChem CID 18598931) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[3-[2-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 18598931 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[3-[2-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenoxy]acetic acid |
| SMILES | CCCCCCOC[C@@H]1[C@H](CCc2cccc(OCC(=O)O)c2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H34O5/c1-2-3-4-5-13-26-15-20-19(21-11-12-22(20)28-21)10-9-17-7-6-8-18(14-17)27-16-23(24)25/h6-8,14,19-22H,2-5,9-13,15-16H2,1H3,(H,24,25)/t19-,20+,21-,22+/m0/s1 |
| InChIKey | YHUQECDJHQNENZ-LNRXMEIDSA-N |
| XLogP | 4.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|