C24H36O5 — CID 18598925
2-[3-[[(1S,2S,3R,4R)-3-(3-hexoxypropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenoxy]acetic acid (PubChem CID 18598925) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-[3-[[(1S,2S,3R,4R)-3-(3-hexoxypropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[(1S,2S,3R,4R)-3-(3-hexoxypropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 18598925 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 2-[3-[[(1S,2S,3R,4R)-3-(3-hexoxypropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenoxy]acetic acid |
| SMILES | CCCCCCOCCC[C@@H]1[C@H](Cc2cccc(OCC(=O)O)c2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C24H36O5/c1-2-3-4-5-13-27-14-7-10-20-21(23-12-11-22(20)29-23)16-18-8-6-9-19(15-18)28-17-24(25)26/h6,8-9,15,20-23H,2-5,7,10-14,16-17H2,1H3,(H,25,26)/t20-,21+,22-,23+/m1/s1 |
| InChIKey | CDRYPHJETRMELV-ACESQOTJSA-N |
| XLogP | 4.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|