C22H30O6 — CID 70505937
2-[3-[[(3R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]phenoxy]acetic acid (PubChem CID 70505937) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[3-[[(3R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[(3R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70505937 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-[3-[[(3R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]phenoxy]acetic acid |
| SMILES | CCCCCC(O)/C=C/C1C(Cc2cccc(OCC(=O)O)c2)C(=O)C[C@H]1O |
| InChI | InChI=1S/C22H30O6/c1-2-3-4-7-16(23)9-10-18-19(21(25)13-20(18)24)12-15-6-5-8-17(11-15)28-14-22(26)27/h5-6,8-11,16,18-20,23-24H,2-4,7,12-14H2,1H3,(H,26,27)/b10-9+/t16?,18?,19?,20-/m1/s1 |
| InChIKey | UWLOPLZLOOZOLZ-WZSWHBGGSA-N |
| XLogP | 2.76 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|