C25H38O3 — CID 89419695
(1R,2R,3R)-3-[(3-butoxyphenyl)methyl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-4-methylidenecyclopentan-1-ol (PubChem CID 89419695) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1R,2R,3R)-3-[(3-butoxyphenyl)methyl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-4-methylidenecyclopentan-1-ol.
| Compound Name | (1R,2R,3R)-3-[(3-butoxyphenyl)methyl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-4-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 89419695 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (1R,2R,3R)-3-[(3-butoxyphenyl)methyl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-4-methylidenecyclopentan-1-ol |
| SMILES | C=C1C[C@@H](O)[C@H](/C=C/[C@@H](O)CCCCC)[C@H]1Cc1cccc(OCCCC)c1 |
| InChI | InChI=1S/C25H38O3/c1-4-6-8-11-21(26)13-14-23-24(19(3)16-25(23)27)18-20-10-9-12-22(17-20)28-15-7-5-2/h9-10,12-14,17,21,23-27H,3-8,11,15-16,18H2,1-2H3/b14-13+/t21-,23+,24-,25+/m0/s1 |
| InChIKey | YRZZDUYQESUAHU-HPPITUBHSA-N |
| XLogP | 5.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|