C26H44O4Si — CID 70589009
(1S,3R,4S,5S)-4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol (PubChem CID 70589009) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (1S,3R,4S,5S)-4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4S,5S)-4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70589009 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (1S,3R,4S,5S)-4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H](Cc2cccc(O[Si](C)(C)C(C)(C)C)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H44O4Si/c1-7-8-9-12-20(27)14-15-22-23(25(29)18-24(22)28)17-19-11-10-13-21(16-19)30-31(5,6)26(2,3)4/h10-11,13-16,20,22-25,27-29H,7-9,12,17-18H2,1-6H3/t20-,22-,23-,24-,25+/m0/s1 |
| InChIKey | ATBGBIHPACCWDV-XFASLETNSA-N |
| XLogP | 5.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|