C17H28ClNO5 — CID 168970123
2-[3-[5-[3-(aminomethyl)phenoxy]pentoxy]propoxy]acetic acid;hydrochloride (PubChem CID 168970123) has the molecular formula C17H28ClNO5 and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-[3-[5-[3-(aminomethyl)phenoxy]pentoxy]propoxy]acetic acid;hydrochloride.
| Compound Name | 2-[3-[5-[3-(aminomethyl)phenoxy]pentoxy]propoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 168970123 |
| Molecular Formula | C17H28ClNO5 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[3-[5-[3-(aminomethyl)phenoxy]pentoxy]propoxy]acetic acid;hydrochloride |
| SMILES | Cl.NCc1cccc(OCCCCCOCCCOCC(=O)O)c1 |
| InChI | InChI=1S/C17H27NO5.ClH/c18-13-15-6-4-7-16(12-15)23-11-3-1-2-8-21-9-5-10-22-14-17(19)20;/h4,6-7,12H,1-3,5,8-11,13-14,18H2,(H,19,20);1H |
| InChIKey | SAVYIFQLMZYQTM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|