C17H27ClFNO5 — CID 168969888
2-[3-[5-[3-(aminomethyl)-4-fluorophenoxy]pentoxy]propoxy]acetic acid;hydrochloride (PubChem CID 168969888) has the molecular formula C17H27ClFNO5 and a molecular weight of 379.86 g/mol. Its IUPAC name is 2-[3-[5-[3-(aminomethyl)-4-fluorophenoxy]pentoxy]propoxy]acetic acid;hydrochloride.
| Compound Name | 2-[3-[5-[3-(aminomethyl)-4-fluorophenoxy]pentoxy]propoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 168969888 |
| Molecular Formula | C17H27ClFNO5 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[3-[5-[3-(aminomethyl)-4-fluorophenoxy]pentoxy]propoxy]acetic acid;hydrochloride |
| SMILES | Cl.NCc1cc(OCCCCCOCCCOCC(=O)O)ccc1F |
| InChI | InChI=1S/C17H26FNO5.ClH/c18-16-6-5-15(11-14(16)12-19)24-10-3-1-2-7-22-8-4-9-23-13-17(20)21;/h5-6,11H,1-4,7-10,12-13,19H2,(H,20,21);1H |
| InChIKey | ZPLBKWPWWDUVHH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|