C18H28FNO4S — CID 146587612
S-methyl 2-[3-[3-[3-fluoro-4-(propan-2-ylamino)phenoxy]propoxy]propoxy]ethanethioate (PubChem CID 146587612) has the molecular formula C18H28FNO4S and a molecular weight of 373.49 g/mol. Its IUPAC name is S-methyl 2-[3-[3-[3-fluoro-4-(propan-2-ylamino)phenoxy]propoxy]propoxy]ethanethioate.
| Compound Name | S-methyl 2-[3-[3-[3-fluoro-4-(propan-2-ylamino)phenoxy]propoxy]propoxy]ethanethioate |
|---|---|
| PubChem CID | 146587612 |
| Molecular Formula | C18H28FNO4S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | S-methyl 2-[3-[3-[3-fluoro-4-(propan-2-ylamino)phenoxy]propoxy]propoxy]ethanethioate |
| SMILES | CSC(=O)COCCCOCCCOc1ccc(NC(C)C)c(F)c1 |
| InChI | InChI=1S/C18H28FNO4S/c1-14(2)20-17-7-6-15(12-16(17)19)24-11-5-9-22-8-4-10-23-13-18(21)25-3/h6-7,12,14,20H,4-5,8-11,13H2,1-3H3 |
| InChIKey | FSZXJHNJVURUTN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|