C24H41NO6 — CID 168970083
methyl 6-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]hexanoate (PubChem CID 168970083) has the molecular formula C24H41NO6 and a molecular weight of 439.59 g/mol. Its IUPAC name is methyl 6-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]hexanoate.
| Compound Name | methyl 6-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]hexanoate |
|---|---|
| PubChem CID | 168970083 |
| Molecular Formula | C24H41NO6 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | methyl 6-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]hexanoate |
| SMILES | COC(=O)CCCCCOCCOCCOCCCCCCOc1cccc(CN)c1 |
| InChI | InChI=1S/C24H41NO6/c1-27-24(26)12-5-4-7-14-29-17-19-30-18-16-28-13-6-2-3-8-15-31-23-11-9-10-22(20-23)21-25/h9-11,20H,2-8,12-19,21,25H2,1H3 |
| InChIKey | QUZJXJMHHYICJJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|