C19H28O4 — CID 70399750
7-[(3R,4S)-4-(2-phenoxyethyl)oxolan-3-yl]heptanoic acid (PubChem CID 70399750) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(2-phenoxyethyl)oxolan-3-yl]heptanoic acid.
| Compound Name | 7-[(3R,4S)-4-(2-phenoxyethyl)oxolan-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 70399750 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 7-[(3R,4S)-4-(2-phenoxyethyl)oxolan-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1COC[C@H]1CCOc1ccccc1 |
| InChI | InChI=1S/C19H28O4/c20-19(21)11-7-2-1-4-8-16-14-22-15-17(16)12-13-23-18-9-5-3-6-10-18/h3,5-6,9-10,16-17H,1-2,4,7-8,11-15H2,(H,20,21)/t16-,17+/m0/s1 |
| InChIKey | DPIFIGLVBKHNID-DLBZAZTESA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|