2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid

C13H16O3 — CID 21109018

IUPAC2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid
SMILESO=C(O)C[C@@H]1C[C@H]1CCOc1ccccc1
InChIInChI=1S/C13H16O3/c14-13(15)9-11-8-10(11)6-7-16-12-4-2-1-3-5-12/h1-5,10-11H,6-9H2,(H,14,15)/t10-,11+/m1/s1
InChIKeyBVGSQZOXHISERI-MNOVXSKESA-N
MW220.27 g/mol
LogP2.57
Rot. Bonds6

About 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid

2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid (PubChem CID 21109018) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid
PubChem CID21109018
Molecular FormulaC13H16O3
Molecular Weight220.27 g/mol
Exact Mass220.11
IUPAC Name2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid
SMILESO=C(O)C[C@@H]1C[C@H]1CCOc1ccccc1
InChIInChI=1S/C13H16O3/c14-13(15)9-11-8-10(11)6-7-16-12-4-2-1-3-5-12/h1-5,10-11H,6-9H2,(H,14,15)/t10-,11+/m1/s1
InChIKeyBVGSQZOXHISERI-MNOVXSKESA-N
XLogP2.57
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid (CID 21109018) is 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid is O=C(O)C[C@@H]1C[C@H]1CCOc1ccccc1.
What is the InChIKey of 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid?
The InChIKey is BVGSQZOXHISERI-MNOVXSKESA-N. The full InChI is InChI=1S/C13H16O3/c14-13(15)9-11-8-10(11)6-7-16-12-4-2-1-3-5-12/h1-5,10-11H,6-9H2,(H,14,15)/t10-,11+/m1/s1.
What are the key properties of 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid?
2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid has a molecular weight of 220.27 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S)-2-(2-phenoxyethyl)cyclopropyl]acetic acid is sourced from PubChem (CID 21109018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).