7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid

C15H26O4 — CID 54408449

IUPAC7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid
SMILESO=C(O)CCCCCC[C@@H]1COC[C@H]1COC1CC1
InChIInChI=1S/C15H26O4/c16-15(17)6-4-2-1-3-5-12-9-18-10-13(12)11-19-14-7-8-14/h12-14H,1-11H2,(H,16,17)/t12-,13+/m1/s1
InChIKeyVSKFDBYZUYXGQJ-OLZOCXBDSA-N
MW270.37 g/mol
LogP2.85
Rot. Bonds10

About 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid

7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid (PubChem CID 54408449) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid.

Molecular Properties

Compound Name7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid
PubChem CID54408449
Molecular FormulaC15H26O4
Molecular Weight270.37 g/mol
Exact Mass270.18
IUPAC Name7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid
SMILESO=C(O)CCCCCC[C@@H]1COC[C@H]1COC1CC1
InChIInChI=1S/C15H26O4/c16-15(17)6-4-2-1-3-5-12-9-18-10-13(12)11-19-14-7-8-14/h12-14H,1-11H2,(H,16,17)/t12-,13+/m1/s1
InChIKeyVSKFDBYZUYXGQJ-OLZOCXBDSA-N
XLogP2.85
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid?
The IUPAC name of 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid (CID 54408449) is 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid.
What is the SMILES notation for 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid?
The canonical SMILES for 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid is O=C(O)CCCCCC[C@@H]1COC[C@H]1COC1CC1.
What is the InChIKey of 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid?
The InChIKey is VSKFDBYZUYXGQJ-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H26O4/c16-15(17)6-4-2-1-3-5-12-9-18-10-13(12)11-19-14-7-8-14/h12-14H,1-11H2,(H,16,17)/t12-,13+/m1/s1.
What are the key properties of 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid?
7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid has a molecular weight of 270.37 g/mol, XLogP of 2.85, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3S,4S)-4-(cyclopropyloxymethyl)oxolan-3-yl]heptanoic acid is sourced from PubChem (CID 54408449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).