About 8-cyclobutyloctanoic acid
8-cyclobutyloctanoic acid (PubChem CID 72551210) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 8-cyclobutyloctanoic acid.
Molecular Properties
| Compound Name | 8-cyclobutyloctanoic acid |
| PubChem CID | 72551210 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 8-cyclobutyloctanoic acid |
| SMILES | O=C(O)CCCCCCCC1CCC1 |
| InChI | InChI=1S/C12H22O2/c13-12(14)10-5-3-1-2-4-7-11-8-6-9-11/h11H,1-10H2,(H,13,14) |
| InChIKey | CQSHUGGCCGHQJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclobutyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclobutyloctanoic acid?
The IUPAC name of 8-cyclobutyloctanoic acid (CID 72551210) is 8-cyclobutyloctanoic acid.
What is the SMILES notation for 8-cyclobutyloctanoic acid?
The canonical SMILES for 8-cyclobutyloctanoic acid is O=C(O)CCCCCCCC1CCC1.
What is the InChIKey of 8-cyclobutyloctanoic acid?
The InChIKey is CQSHUGGCCGHQJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c13-12(14)10-5-3-1-2-4-7-11-8-6-9-11/h11H,1-10H2,(H,13,14).
What are the key properties of 8-cyclobutyloctanoic acid?
8-cyclobutyloctanoic acid has a molecular weight of 198.31 g/mol, XLogP of 3.60, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclobutyloctanoic acid is sourced from PubChem (CID 72551210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).