About CID 131865884
CID 131865884 (PubChem CID 131865884) has the molecular formula C20H36CaO4
and a molecular weight of 380.58 g/mol.
Molecular Properties
| Compound Name | CID 131865884 |
| PubChem CID | 131865884 |
| Molecular Formula | C20H36CaO4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | — |
| SMILES | O=C(O)CCCC1CCCCC1.O=C(O)CCCC1CCCCC1.[Ca] |
| InChI | InChI=1S/2C10H18O2.Ca/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*9H,1-8H2,(H,11,12); |
| InChIKey | GCILQLPLUYHELB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 131865884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131865884?
The IUPAC name of CID 131865884 (CID 131865884) is not available.
What is the SMILES notation for CID 131865884?
The canonical SMILES for CID 131865884 is O=C(O)CCCC1CCCCC1.O=C(O)CCCC1CCCCC1.[Ca].
What is the InChIKey of CID 131865884?
The InChIKey is GCILQLPLUYHELB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H18O2.Ca/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*9H,1-8H2,(H,11,12);.
What are the key properties of CID 131865884?
CID 131865884 has a molecular weight of 380.58 g/mol, XLogP of 5.26, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131865884 is sourced from PubChem (CID 131865884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).