11-(3-deuteriocycloheptyl)undecanoic acid

C18H34O2 — CID 10731719

IUPAC11-(3-deuteriocycloheptyl)undecanoic acid
SMILES[2H]C1CCCCC(CCCCCCCCCCC(=O)O)C1
InChIInChI=1S/C18H34O2/c19-18(20)16-12-6-4-2-1-3-5-9-13-17-14-10-7-8-11-15-17/h17H,1-16H2,(H,19,20)/i10D
InChIKeyOMZUUGOYASJZKP-MMIHMFRQSA-N
MW283.47 g/mol
LogP5.94
Rot. Bonds11

About 11-(3-deuteriocycloheptyl)undecanoic acid

11-(3-deuteriocycloheptyl)undecanoic acid (PubChem CID 10731719) has the molecular formula C18H34O2 and a molecular weight of 283.47 g/mol. Its IUPAC name is 11-(3-deuteriocycloheptyl)undecanoic acid.

Molecular Properties

Compound Name11-(3-deuteriocycloheptyl)undecanoic acid
PubChem CID10731719
Molecular FormulaC18H34O2
Molecular Weight283.47 g/mol
Exact Mass283.26
IUPAC Name11-(3-deuteriocycloheptyl)undecanoic acid
SMILES[2H]C1CCCCC(CCCCCCCCCCC(=O)O)C1
InChIInChI=1S/C18H34O2/c19-18(20)16-12-6-4-2-1-3-5-9-13-17-14-10-7-8-11-15-17/h17H,1-16H2,(H,19,20)/i10D
InChIKeyOMZUUGOYASJZKP-MMIHMFRQSA-N
XLogP5.94
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds11
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500283.47
LogP ≤ 55.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 11-(3-deuteriocycloheptyl)undecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 11-(3-deuteriocycloheptyl)undecanoic acid?
The IUPAC name of 11-(3-deuteriocycloheptyl)undecanoic acid (CID 10731719) is 11-(3-deuteriocycloheptyl)undecanoic acid.
What is the SMILES notation for 11-(3-deuteriocycloheptyl)undecanoic acid?
The canonical SMILES for 11-(3-deuteriocycloheptyl)undecanoic acid is [2H]C1CCCCC(CCCCCCCCCCC(=O)O)C1.
What is the InChIKey of 11-(3-deuteriocycloheptyl)undecanoic acid?
The InChIKey is OMZUUGOYASJZKP-MMIHMFRQSA-N. The full InChI is InChI=1S/C18H34O2/c19-18(20)16-12-6-4-2-1-3-5-9-13-17-14-10-7-8-11-15-17/h17H,1-16H2,(H,19,20)/i10D.
What are the key properties of 11-(3-deuteriocycloheptyl)undecanoic acid?
11-(3-deuteriocycloheptyl)undecanoic acid has a molecular weight of 283.47 g/mol, XLogP of 5.94, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(3-deuteriocycloheptyl)undecanoic acid is sourced from PubChem (CID 10731719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).