About 5-(oxolan-3-yl)pentanoic acid
5-(oxolan-3-yl)pentanoic acid (PubChem CID 142409072) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 5-(oxolan-3-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(oxolan-3-yl)pentanoic acid |
| PubChem CID | 142409072 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 5-(oxolan-3-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1CCOC1 |
| InChI | InChI=1S/C9H16O3/c10-9(11)4-2-1-3-8-5-6-12-7-8/h8H,1-7H2,(H,10,11) |
| InChIKey | XHSIUKWADBJYAG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxolan-3-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolan-3-yl)pentanoic acid?
The IUPAC name of 5-(oxolan-3-yl)pentanoic acid (CID 142409072) is 5-(oxolan-3-yl)pentanoic acid.
What is the SMILES notation for 5-(oxolan-3-yl)pentanoic acid?
The canonical SMILES for 5-(oxolan-3-yl)pentanoic acid is O=C(O)CCCCC1CCOC1.
What is the InChIKey of 5-(oxolan-3-yl)pentanoic acid?
The InChIKey is XHSIUKWADBJYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c10-9(11)4-2-1-3-8-5-6-12-7-8/h8H,1-7H2,(H,10,11).
What are the key properties of 5-(oxolan-3-yl)pentanoic acid?
5-(oxolan-3-yl)pentanoic acid has a molecular weight of 172.22 g/mol, XLogP of 1.67, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolan-3-yl)pentanoic acid is sourced from PubChem (CID 142409072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).