C22H32N2O4 — CID 54564240
7-[(1S,2R,3S,4R)-3-[[2-(2-phenylacetyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 54564240) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 7-[(1S,2R,3S,4R)-3-[[2-(2-phenylacetyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 7-[(1S,2R,3S,4R)-3-[[2-(2-phenylacetyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 54564240 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 7-[(1S,2R,3S,4R)-3-[[2-(2-phenylacetyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CNNC(=O)Cc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H32N2O4/c25-21(14-16-8-4-3-5-9-16)24-23-15-18-17(19-12-13-20(18)28-19)10-6-1-2-7-11-22(26)27/h3-5,8-9,17-20,23H,1-2,6-7,10-15H2,(H,24,25)(H,26,27)/t17-,18-,19+,20-/m1/s1 |
| InChIKey | ZSRUPDJWRLNMPU-YSTOQKLRSA-N |
| XLogP | 3.07 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|