C23H33N3O5 — CID 88676131
7-[(1R,2S,4R,5S,6R,7R)-7-[[2-[(2S)-2-amino-3-phenylpropanoyl]hydrazinyl]methyl]-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]heptanoic acid (PubChem CID 88676131) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 7-[(1R,2S,4R,5S,6R,7R)-7-[[2-[(2S)-2-amino-3-phenylpropanoyl]hydrazinyl]methyl]-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]heptanoic acid.
| Compound Name | 7-[(1R,2S,4R,5S,6R,7R)-7-[[2-[(2S)-2-amino-3-phenylpropanoyl]hydrazinyl]methyl]-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]heptanoic acid |
|---|---|
| PubChem CID | 88676131 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 7-[(1R,2S,4R,5S,6R,7R)-7-[[2-[(2S)-2-amino-3-phenylpropanoyl]hydrazinyl]methyl]-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]heptanoic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NNC[C@H]1[C@@H](CCCCCCC(=O)O)[C@@H]2O[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C23H33N3O5/c24-17(12-14-8-4-3-5-9-14)23(29)26-25-13-16-15(10-6-1-2-7-11-18(27)28)19-21-22(31-21)20(16)30-19/h3-5,8-9,15-17,19-22,25H,1-2,6-7,10-13,24H2,(H,26,29)(H,27,28)/t15-,16+,17+,19+,20-,21-,22+/m1/s1 |
| InChIKey | ISKFYUZIHCFLLD-CISZBEMNSA-N |
| XLogP | 1.38 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|