C22H38N2O6 — CID 22837373
7-[(1S,2S,3S,4R)-3-[[[2-[hexanoyl(hydroxy)amino]acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 22837373) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is 7-[(1S,2S,3S,4R)-3-[[[2-[hexanoyl(hydroxy)amino]acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 7-[(1S,2S,3S,4R)-3-[[[2-[hexanoyl(hydroxy)amino]acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 22837373 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 7-[(1S,2S,3S,4R)-3-[[[2-[hexanoyl(hydroxy)amino]acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | CCCCCC(=O)N(O)CC(=O)NC[C@@H]1[C@H](CCCCCCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C22H38N2O6/c1-2-3-6-10-21(26)24(29)15-20(25)23-14-17-16(18-12-13-19(17)30-18)9-7-4-5-8-11-22(27)28/h16-19,29H,2-15H2,1H3,(H,23,25)(H,27,28)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | OASYPPPDNARUSK-ZSYWTGECSA-N |
| XLogP | 3.12 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|