C21H34N2O5 — CID 57205420
7-[3-[2-[[2-(but-2-enoylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 57205420) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is 7-[3-[2-[[2-(but-2-enoylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 7-[3-[2-[[2-(but-2-enoylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 57205420 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 7-[3-[2-[[2-(but-2-enoylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | CC=CC(=O)NCC(=O)NCCC1C2CCC(O2)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H34N2O5/c1-2-7-19(24)23-14-20(25)22-13-12-16-15(17-10-11-18(16)28-17)8-5-3-4-6-9-21(26)27/h2,7,15-18H,3-6,8-14H2,1H3,(H,22,25)(H,23,24)(H,26,27) |
| InChIKey | OAFDFMKCGHRJPG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|