C25H35N3O5 — CID 57136850
N-[2-[(1S,2S,3R,4S)-3-(8-hydroxy-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]-2-(phenylcarbamoylamino)acetamide (PubChem CID 57136850) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[2-[(1S,2S,3R,4S)-3-(8-hydroxy-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]-2-(phenylcarbamoylamino)acetamide.
| Compound Name | N-[2-[(1S,2S,3R,4S)-3-(8-hydroxy-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]-2-(phenylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 57136850 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-[2-[(1S,2S,3R,4S)-3-(8-hydroxy-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]-2-(phenylcarbamoylamino)acetamide |
| SMILES | O=C(CO)CCCC=CC[C@@H]1[C@H](CCNC(=O)CNC(=O)Nc2ccccc2)[C@@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C25H35N3O5/c29-17-19(30)10-6-1-2-7-11-20-21(23-13-12-22(20)33-23)14-15-26-24(31)16-27-25(32)28-18-8-4-3-5-9-18/h2-5,7-9,20-23,29H,1,6,10-17H2,(H,26,31)(H2,27,28,32)/t20-,21+,22+,23+/m1/s1 |
| InChIKey | OWEWVOSKEOQARV-LDVJMBRRSA-N |
| XLogP | 2.79 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|