C23H37ClN2O4 — CID 57221783
N-[2-[[(1R,2S,3S,4S)-3-(8-chloro-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylamino]-2-oxoethyl]hexanamide (PubChem CID 57221783) has the molecular formula C23H37ClN2O4 and a molecular weight of 441.01 g/mol. Its IUPAC name is N-[2-[[(1R,2S,3S,4S)-3-(8-chloro-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylamino]-2-oxoethyl]hexanamide.
| Compound Name | N-[2-[[(1R,2S,3S,4S)-3-(8-chloro-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylamino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 57221783 |
| Molecular Formula | C23H37ClN2O4 |
| Molecular Weight | 441.01 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-[2-[[(1R,2S,3S,4S)-3-(8-chloro-7-oxooct-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylamino]-2-oxoethyl]hexanamide |
| SMILES | CCCCCC(=O)NCC(=O)NC[C@@H]1[C@H](CC=CCCCC(=O)CCl)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H37ClN2O4/c1-2-3-6-11-22(28)26-16-23(29)25-15-19-18(20-12-13-21(19)30-20)10-8-5-4-7-9-17(27)14-24/h5,8,18-21H,2-4,6-7,9-16H2,1H3,(H,25,29)(H,26,28)/t18-,19+,20-,21+/m0/s1 |
| InChIKey | ZYMNZFVKHRKPOW-JSXRDJHFSA-N |
| XLogP | 3.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|