C23H35F2NO5 — CID 70426947
(Z)-2,2-difluoro-7-[(1R,2R,3R,4S)-3-[(4-oxononanoylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70426947) has the molecular formula C23H35F2NO5 and a molecular weight of 443.53 g/mol. Its IUPAC name is (Z)-2,2-difluoro-7-[(1R,2R,3R,4S)-3-[(4-oxononanoylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-2,2-difluoro-7-[(1R,2R,3R,4S)-3-[(4-oxononanoylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70426947 |
| Molecular Formula | C23H35F2NO5 |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (Z)-2,2-difluoro-7-[(1R,2R,3R,4S)-3-[(4-oxononanoylamino)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)CCC(=O)NC[C@H]1[C@@H](C/C=C\CCC(F)(F)C(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C23H35F2NO5/c1-2-3-5-8-16(27)10-13-21(28)26-15-18-17(19-11-12-20(18)31-19)9-6-4-7-14-23(24,25)22(29)30/h4,6,17-20H,2-3,5,7-15H2,1H3,(H,26,28)(H,29,30)/b6-4-/t17-,18+,19-,20+/m1/s1 |
| InChIKey | KXVRXQLXUNQABH-DSEQFTDHSA-N |
| XLogP | 4.27 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|