C22H36N2O6 — CID 70433581
(Z,2R)-7-[(1R,3R,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-hydroxyhept-5-enoic acid (PubChem CID 70433581) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is (Z,2R)-7-[(1R,3R,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-hydroxyhept-5-enoic acid.
| Compound Name | (Z,2R)-7-[(1R,3R,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 70433581 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (Z,2R)-7-[(1R,3R,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-hydroxyhept-5-enoic acid |
| SMILES | CCCCCC(=O)NCC(=O)NC[C@H]1C(C/C=C\CC[C@@H](O)C(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H36N2O6/c1-2-3-5-10-20(26)24-14-21(27)23-13-16-15(18-11-12-19(16)30-18)8-6-4-7-9-17(25)22(28)29/h4,6,15-19,25H,2-3,5,7-14H2,1H3,(H,23,27)(H,24,26)(H,28,29)/b6-4-/t15?,16-,17+,18+,19-/m0/s1 |
| InChIKey | WRBJXFCEBFMPSH-YJMKRJQUSA-N |
| XLogP | 1.76 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|