C24H41N3O3 — CID 54159329
7-[(1R,2R,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]-N-methylhept-5-enamide (PubChem CID 54159329) has the molecular formula C24H41N3O3 and a molecular weight of 419.61 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]-N-methylhept-5-enamide.
| Compound Name | 7-[(1R,2R,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]-N-methylhept-5-enamide |
|---|---|
| PubChem CID | 54159329 |
| Molecular Formula | C24H41N3O3 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]-N-methylhept-5-enamide |
| SMILES | CCCCCC(=O)NCC(=O)NC[C@H]1[C@H]2CC[C@H](C2)[C@H]1CC=CCCCC(=O)NC |
| InChI | InChI=1S/C24H41N3O3/c1-3-4-7-12-23(29)27-17-24(30)26-16-21-19-14-13-18(15-19)20(21)10-8-5-6-9-11-22(28)25-2/h5,8,18-21H,3-4,6-7,9-17H2,1-2H3,(H,25,28)(H,26,30)(H,27,29)/t18-,19+,20-,21+/m1/s1 |
| InChIKey | ONHVJVMTQDSVEF-MHTWAQMVSA-N |
| XLogP | 3.32 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|