C23H38N2O4 — CID 54298128
7-[(1R,2S,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-6-enoic acid (PubChem CID 54298128) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is 7-[(1R,2S,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-6-enoic acid.
| Compound Name | 7-[(1R,2S,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-6-enoic acid |
|---|---|
| PubChem CID | 54298128 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 7-[(1R,2S,3S,4S)-3-[[[2-(hexanoylamino)acetyl]amino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-6-enoic acid |
| SMILES | CCCCCC(=O)NCC(=O)NC[C@H]1[C@H]2CC[C@H](C2)[C@H]1C=CCCCCC(=O)O |
| InChI | InChI=1S/C23H38N2O4/c1-2-3-6-10-21(26)25-16-22(27)24-15-20-18-13-12-17(14-18)19(20)9-7-4-5-8-11-23(28)29/h7,9,17-20H,2-6,8,10-16H2,1H3,(H,24,27)(H,25,26)(H,28,29)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | SCFJQWRGKFVQPS-WCIQWLHISA-N |
| XLogP | 3.66 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|