C21H35N3O5 — CID 67834062
(Z)-7-[(1R,2R,3R,4S)-3-[[[2-(butylcarbamoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 67834062) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-[[[2-(butylcarbamoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-[[[2-(butylcarbamoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67834062 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-[[[2-(butylcarbamoylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCNC(=O)NCC(=O)NC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H35N3O5/c1-2-3-12-22-21(28)24-14-19(25)23-13-16-15(17-10-11-18(16)29-17)8-6-4-5-7-9-20(26)27/h4,6,15-18H,2-3,5,7-14H2,1H3,(H,23,25)(H,26,27)(H2,22,24,28)/b6-4-/t15-,16+,17-,18+/m1/s1 |
| InChIKey | MJLVWHQLOVTJQU-TVWHRPDXSA-N |
| XLogP | 2.20 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|