C21H34N2O5S — CID 57037434
7-[(1R,2R,3R,4S)-3-[[[3-(butoxyamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 57037434) has the molecular formula C21H34N2O5S and a molecular weight of 426.58 g/mol. Its IUPAC name is 7-[(1R,2R,3R,4S)-3-[[[3-(butoxyamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,4S)-3-[[[3-(butoxyamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57037434 |
| Molecular Formula | C21H34N2O5S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 7-[(1R,2R,3R,4S)-3-[[[3-(butoxyamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCONC(=S)CC(=O)NC[C@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H34N2O5S/c1-2-3-12-27-23-20(29)13-19(24)22-14-16-15(17-10-11-18(16)28-17)8-6-4-5-7-9-21(25)26/h4,6,15-18H,2-3,5,7-14H2,1H3,(H,22,24)(H,23,29)(H,25,26)/t15-,16+,17-,18+/m1/s1 |
| InChIKey | GUHHNXXVVVEZDF-XDNAFOTISA-N |
| XLogP | 3.14 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|