C22H29NO4S — CID 150577453
7-[2-(4-benzylphenyl)ethylsulfonylamino]heptanoic acid (PubChem CID 150577453) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 7-[2-(4-benzylphenyl)ethylsulfonylamino]heptanoic acid.
| Compound Name | 7-[2-(4-benzylphenyl)ethylsulfonylamino]heptanoic acid |
|---|---|
| PubChem CID | 150577453 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 7-[2-(4-benzylphenyl)ethylsulfonylamino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNS(=O)(=O)CCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H29NO4S/c24-22(25)10-6-1-2-7-16-23-28(26,27)17-15-19-11-13-21(14-12-19)18-20-8-4-3-5-9-20/h3-5,8-9,11-14,23H,1-2,6-7,10,15-18H2,(H,24,25) |
| InChIKey | INCRCXZSXFGXPN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|