About benzyl [(Z)-non-4-enyl] carbonate
benzyl [(Z)-non-4-enyl] carbonate (PubChem CID 135274084) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is benzyl [(Z)-non-4-enyl] carbonate.
Molecular Properties
| Compound Name | benzyl [(Z)-non-4-enyl] carbonate |
| PubChem CID | 135274084 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | benzyl [(Z)-non-4-enyl] carbonate |
| SMILES | CCCC/C=C\CCCOC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24O3/c1-2-3-4-5-6-7-11-14-19-17(18)20-15-16-12-9-8-10-13-16/h5-6,8-10,12-13H,2-4,7,11,14-15H2,1H3/b6-5- |
| InChIKey | MBAUPTBIQZDTSX-WAYWQWQTSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl [(Z)-non-4-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl [(Z)-non-4-enyl] carbonate?
The IUPAC name of benzyl [(Z)-non-4-enyl] carbonate (CID 135274084) is benzyl [(Z)-non-4-enyl] carbonate.
What is the SMILES notation for benzyl [(Z)-non-4-enyl] carbonate?
The canonical SMILES for benzyl [(Z)-non-4-enyl] carbonate is CCCC/C=C\CCCOC(=O)OCc1ccccc1.
What is the InChIKey of benzyl [(Z)-non-4-enyl] carbonate?
The InChIKey is MBAUPTBIQZDTSX-WAYWQWQTSA-N. The full InChI is InChI=1S/C17H24O3/c1-2-3-4-5-6-7-11-14-19-17(18)20-15-16-12-9-8-10-13-16/h5-6,8-10,12-13H,2-4,7,11,14-15H2,1H3/b6-5-.
What are the key properties of benzyl [(Z)-non-4-enyl] carbonate?
benzyl [(Z)-non-4-enyl] carbonate has a molecular weight of 276.38 g/mol, XLogP of 4.87, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl [(Z)-non-4-enyl] carbonate is sourced from PubChem (CID 135274084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).