About [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate
[(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate (PubChem CID 132600083) has the molecular formula C36H54N2O6
and a molecular weight of 610.84 g/mol. Its IUPAC name is [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate.
Molecular Properties
| Compound Name | [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate |
| PubChem CID | 132600083 |
| Molecular Formula | C36H54N2O6 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.40 |
| IUPAC Name | [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate |
| SMILES | Nc1ccc(COC(=O)OCCCCCCCCC/C=C/CCCCCCCCCOC(=O)OCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C36H54N2O6/c37-33-23-19-31(20-24-33)29-43-35(39)41-27-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-28-42-36(40)44-30-32-21-25-34(38)26-22-32/h1-2,19-26H,3-18,27-30,37-38H2/b2-1+ |
| InChIKey | NGJFCWVQDJWPGQ-OWOJBTEDSA-N |
| XLogP | 9.66 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate?
The IUPAC name of [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate (CID 132600083) is [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate.
What is the SMILES notation for [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate?
The canonical SMILES for [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate is Nc1ccc(COC(=O)OCCCCCCCCC/C=C/CCCCCCCCCOC(=O)OCc2ccc(N)cc2)cc1.
What is the InChIKey of [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate?
The InChIKey is NGJFCWVQDJWPGQ-OWOJBTEDSA-N. The full InChI is InChI=1S/C36H54N2O6/c37-33-23-19-31(20-24-33)29-43-35(39)41-27-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-28-42-36(40)44-30-32-21-25-34(38)26-22-32/h1-2,19-26H,3-18,27-30,37-38H2/b2-1+.
What are the key properties of [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate?
[(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate has a molecular weight of 610.84 g/mol, XLogP of 9.66, 24 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-20-[(4-aminophenyl)methoxycarbonyloxy]icos-10-enyl] (4-aminophenyl)methyl carbonate is sourced from PubChem (CID 132600083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).