C18H19NO4S — CID 134944273
dimethyl 1-methyl-2-thiophen-2-yl-2,4-dihydroquinoline-3,3-dicarboxylate (PubChem CID 134944273) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is dimethyl 1-methyl-2-thiophen-2-yl-2,4-dihydroquinoline-3,3-dicarboxylate.
| Compound Name | dimethyl 1-methyl-2-thiophen-2-yl-2,4-dihydroquinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 134944273 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | dimethyl 1-methyl-2-thiophen-2-yl-2,4-dihydroquinoline-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2N(C)C1c1cccs1 |
| InChI | InChI=1S/C18H19NO4S/c1-19-13-8-5-4-7-12(13)11-18(16(20)22-2,17(21)23-3)15(19)14-9-6-10-24-14/h4-10,15H,11H2,1-3H3 |
| InChIKey | DIPXQLLNJVHOQJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|