C20H20FNO4 — CID 51051192
dimethyl 2-(4-fluorophenyl)-1-methyl-2,4-dihydroquinoline-3,3-dicarboxylate (PubChem CID 51051192) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is dimethyl 2-(4-fluorophenyl)-1-methyl-2,4-dihydroquinoline-3,3-dicarboxylate.
| Compound Name | dimethyl 2-(4-fluorophenyl)-1-methyl-2,4-dihydroquinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 51051192 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | dimethyl 2-(4-fluorophenyl)-1-methyl-2,4-dihydroquinoline-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2N(C)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO4/c1-22-16-7-5-4-6-14(16)12-20(18(23)25-2,19(24)26-3)17(22)13-8-10-15(21)11-9-13/h4-11,17H,12H2,1-3H3 |
| InChIKey | OSPROLKDZNZTDX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|