C16H16FO4- — CID 7813744
(1R,6R)-6-(4-fluorophenyl)-1-methoxycarbonyl-4-methylcyclohex-3-ene-1-carboxylate (PubChem CID 7813744) has the molecular formula C16H16FO4- and a molecular weight of 291.30 g/mol. Its IUPAC name is (1R,6R)-6-(4-fluorophenyl)-1-methoxycarbonyl-4-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6R)-6-(4-fluorophenyl)-1-methoxycarbonyl-4-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7813744 |
| Molecular Formula | C16H16FO4- |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (1R,6R)-6-(4-fluorophenyl)-1-methoxycarbonyl-4-methylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C(=O)[O-])CC=C(C)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FO4/c1-10-7-8-16(14(18)19,15(20)21-2)13(9-10)11-3-5-12(17)6-4-11/h3-7,13H,8-9H2,1-2H3,(H,18,19)/p-1/t13-,16-/m1/s1 |
| InChIKey | GWPFHHJBPMLLPU-CZUORRHYSA-M |
| XLogP | 1.56 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|